CAS 651769-78-7 appears in our catalog under these names: Xanthine oxidoreductase-IN-3/ 98.1% (existing batch purity), N-(4-Chlorophenyl)-4-(1H-tetrazol-5-yl)benzamide, 98%, 98%, Xanthine oxidoreductase-IN-3. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
N-(4-chlorophenyl)-4-(2H-tetrazol-5-yl)benzamide (CAS 651769-78-7) is a chemical compound with the molecular formula C14H10ClN5O and a molecular weight of 299.71 g/mol. IUPAC name: N-(4-chlorophenyl)-4-(2H-tetrazol-5-yl)benzamide. InChIKey: SLMPSGMCNFHIAY-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN5O |
|---|---|
| Molecular weight | 299.71 g/mol |
| IUPAC name | N-(4-chlorophenyl)-4-(2H-tetrazol-5-yl)benzamide |
| InChIKey | SLMPSGMCNFHIAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNN=N2)C(=O)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)