CAS 65183-01-9 is the registry number for 2-(2,3-Dichlorophenyl)thioacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2,3-dichlorophenyl)ethanethioamide (CAS 65183-01-9) is a chemical compound with the molecular formula C8H7Cl2NS and a molecular weight of 220.12 g/mol. IUPAC name: N-(2,3-dichlorophenyl)ethanethioamide. InChIKey: FFFBLAYMZIHILM-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NS |
|---|---|
| Molecular weight | 220.12 g/mol |
| IUPAC name | N-(2,3-dichlorophenyl)ethanethioamide |
| InChIKey | FFFBLAYMZIHILM-UHFFFAOYSA-N |
| SMILES | CC(=S)NC1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)