CAS 652-03-9 appears in our catalog under these names: Tetrafluorophthalic Acid, Tetrafluorophthalic Acid, >98.0%(T), Tetrafluorophthalic acid 97%, TETRAFLUOROPHTHALIC ACID, 98%, Tetrafluorophthalic Acid, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 500g, 5g, 10g, 1g.
3,4,5,6-tetrafluorophthalic acid (CAS 652-03-9) is a chemical compound with the molecular formula C8H2F4O4 and a molecular weight of 238.09 g/mol. IUPAC name: 3,4,5,6-tetrafluorophthalic acid. InChIKey: YJLVXRPNNDKMMO-UHFFFAOYSA-N.
| Molecular formula | C8H2F4O4 |
|---|---|
| Molecular weight | 238.09 g/mol |
| IUPAC name | 3,4,5,6-tetrafluorophthalic acid |
| InChIKey | YJLVXRPNNDKMMO-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)