CAS 652-22-2 appears in our catalog under these names: Octafluoroacetophenone, 95%, Octafluoroacetophenone 95%, Perfluoroacetophenone, 98%+(GC),RG. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanone (CAS 652-22-2) is a chemical compound with the molecular formula C8F8O and a molecular weight of 264.07 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanone. InChIKey: IIDKLGQPNPUKBQ-UHFFFAOYSA-N.
| Molecular formula | C8F8O |
|---|---|
| Molecular weight | 264.07 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| InChIKey | IIDKLGQPNPUKBQ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)