CAS 652-39-1 appears in our catalog under these names: 3–Fluorophthalic anhydride, 3-Fluorophthalic anhydride, 98% , 3-Fluorophthalic Anhydride, >98.0%(GC), 3-Fluorophthalic anhydride, 4-Fluoroisobenzofuran-1,3-dione 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 50g.
4-fluoro-2-benzofuran-1,3-dione (CAS 652-39-1) is a chemical compound with the molecular formula C8H3FO3 and a molecular weight of 166.11 g/mol. IUPAC name: 4-fluoro-2-benzofuran-1,3-dione. InChIKey: WWJAZKZLSDRAIV-UHFFFAOYSA-N.
| Molecular formula | C8H3FO3 |
|---|---|
| Molecular weight | 166.11 g/mol |
| IUPAC name | 4-fluoro-2-benzofuran-1,3-dione |
| InChIKey | WWJAZKZLSDRAIV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)OC2=O |
Computed by PubChem (NCBI)