CAS 65281-77-8 appears in our catalog under these names: 12,14-Dichlorodehydroabietic Acid (>90%), 12,14-Dichlorodehydroabietic acid. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 1mg, 2mg, 5mg, 5 mg, 1 mg, 10 mg.
(1R,4aS,10aR)-6,8-dichloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (CAS 65281-77-8) is a chemical compound with the molecular formula C20H26Cl2O2 and a molecular weight of 369.3 g/mol. IUPAC name: (1R,4aS,10aR)-6,8-dichloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid. InChIKey: RKQWIQSTFSBVMQ-CDHQVMDDSA-N.
| Molecular formula | C20H26Cl2O2 |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | (1R,4aS,10aR)-6,8-dichloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| InChIKey | RKQWIQSTFSBVMQ-CDHQVMDDSA-N |
| SMILES | CC(C)C1=C(C=C2C(=C1Cl)CC[C@@H]3[C@@]2(CCC[C@@]3(C)C(=O)O)C)Cl |
Computed by PubChem (NCBI)