Products 652967-47-0
CAS 652967-47-0 is the registry number for BTB 06061. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N'-bis(6-chloro-1,3-benzothiazol-2-yl)methanedisulfonamide (CAS 652967-47-0) is a chemical compound with the molecular formula C15H10Cl2N4O4S4 and a molecular weight of 509.4 g/mol. IUPAC name: N,N'-bis(6-chloro-1,3-benzothiazol-2-yl)methanedisulfonamide. InChIKey: TYADZWBAUYSPCF-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N4O4S4 |
|---|---|
| Molecular weight | 509.4 g/mol |
| IUPAC name | N,N'-bis(6-chloro-1,3-benzothiazol-2-yl)methanedisulfonamide |
| InChIKey | TYADZWBAUYSPCF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=N2)NS(=O)(=O)CS(=O)(=O)NC3=NC4=C(S3)C=C(C=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
Oprea1_750251, orb2664511