CAS 652971-19-2 is the registry number for (3R,4S)-1-(tert-Butoxycarbonyl)-4-phenylpiperidine-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpiperidine-3-carboxylic acid (CAS 652971-19-2) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpiperidine-3-carboxylic acid. InChIKey: UHRXHCZPUWORFZ-KGLIPLIRSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpiperidine-3-carboxylic acid |
| InChIKey | UHRXHCZPUWORFZ-KGLIPLIRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H](C1)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)