CAS 653-14-5 appears in our catalog under these names: 3-5-DIIODOSALICYLIC ACID CRYSTALLINE, 3-5-DIIODOSALICYLIC ACID CRYSTALLINE &, Lithium 3,5-diiodosalicylate, 95%, Lithium 3,5–diiodosalicylate, Lithium 3,5-diiodosalicylic acid. Offered by: Sigma-Aldrich, Combi-blocks, GLPBio, Biosynth, Roth. Available pack sizes: 25G, 5G, 100g, 10g, 1g, 50g, 250g, 500g.
Lithium 2-hydroxy-3,5-diiodobenzoate (CAS 653-14-5) is a chemical compound with the molecular formula C7H3I2LiO3 and a molecular weight of 395.9 g/mol. IUPAC name: lithium 2-hydroxy-3,5-diiodobenzoate. InChIKey: HLBRJWWTLIAOTE-UHFFFAOYSA-M.
| Molecular formula | C7H3I2LiO3 |
|---|---|
| Molecular weight | 395.9 g/mol |
| IUPAC name | lithium 2-hydroxy-3,5-diiodobenzoate |
| InChIKey | HLBRJWWTLIAOTE-UHFFFAOYSA-M |
| SMILES | [Li+].C1=C(C=C(C(=C1C(=O)[O-])O)I)I |
Computed by PubChem (NCBI)