CAS 65303-82-4 appears in our catalog under these names: 4-Fluoro-3-nitrophenylisocyanate 98%, 4-Fluoro-3-nitrophenyl isocyanate, 95%. Offered by: Ambeed, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g.
1-fluoro-4-isocyanato-2-nitrobenzene (CAS 65303-82-4) is a chemical compound with the molecular formula C7H3FN2O3 and a molecular weight of 182.11 g/mol. IUPAC name: 1-fluoro-4-isocyanato-2-nitrobenzene. InChIKey: KCHOHFPMTUPOJU-UHFFFAOYSA-N.
| Molecular formula | C7H3FN2O3 |
|---|---|
| Molecular weight | 182.11 g/mol |
| IUPAC name | 1-fluoro-4-isocyanato-2-nitrobenzene |
| InChIKey | KCHOHFPMTUPOJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)