CAS 6531-08-4 is the registry number for 3,6-Dichloropyridazine-4-carbonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
3,6-dichloropyridazine-4-carbonyl chloride (CAS 6531-08-4) is a chemical compound with the molecular formula C5HCl3N2O and a molecular weight of 211.43 g/mol. IUPAC name: 3,6-dichloropyridazine-4-carbonyl chloride. InChIKey: UGKIAJNNQAMSHX-UHFFFAOYSA-N.
| Molecular formula | C5HCl3N2O |
|---|---|
| Molecular weight | 211.43 g/mol |
| IUPAC name | 3,6-dichloropyridazine-4-carbonyl chloride |
| InChIKey | UGKIAJNNQAMSHX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1Cl)Cl)C(=O)Cl |
Computed by PubChem (NCBI)