CAS 65310-45-4 is the registry number for 12-Chlorodehydroabietic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
(1R,4aS,10aR)-6-chloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (CAS 65310-45-4) is a chemical compound with the molecular formula C20H27ClO2 and a molecular weight of 334.9 g/mol. IUPAC name: (1R,4aS,10aR)-6-chloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid. InChIKey: LRHCLIUTYPHWLV-MISYRCLQSA-N.
| Molecular formula | C20H27ClO2 |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | (1R,4aS,10aR)-6-chloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| InChIKey | LRHCLIUTYPHWLV-MISYRCLQSA-N |
| SMILES | CC(C)C1=C(C=C2C(=C1)CC[C@@H]3[C@@]2(CCC[C@@]3(C)C(=O)O)C)Cl |
Computed by PubChem (NCBI)