CAS 65316-65-6 is the registry number for Ro 12-7310. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,4E,6E,8E)-9-(4-hydroxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (CAS 65316-65-6) is a chemical compound with the molecular formula C20H24O3 and a molecular weight of 312.4 g/mol. IUPAC name: (2E,4E,6E,8E)-9-(4-hydroxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid. InChIKey: CAAFTBWHFUPDGX-OFCLTBKTSA-N.
| Molecular formula | C20H24O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (2E,4E,6E,8E)-9-(4-hydroxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| InChIKey | CAAFTBWHFUPDGX-OFCLTBKTSA-N |
| SMILES | CC1=CC(=C(C(=C1/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C)C)C)O |
Computed by PubChem (NCBI)