CAS 65340-72-9 appears in our catalog under these names: 4-Amino-8-chloroquinoline, 95%, 8-Chloroquinolin-4-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
8-chloroquinolin-4-amine (CAS 65340-72-9) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 8-chloroquinolin-4-amine. InChIKey: OIXSIWQVJINCRY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 8-chloroquinolin-4-amine |
| InChIKey | OIXSIWQVJINCRY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)Cl)N |
Computed by PubChem (NCBI)