CAS 6535-46-2 appears in our catalog under these names: Pigment red 112, 95%, Pigment Red 112 (tech grade), Pigment Red 112, C.I. Pigment red 112. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg, 0,25kg, 0,5kg, 1kg.
3-hydroxy-N-(2-methylphenyl)-4-[(2,4,5-trichlorophenyl)diazenyl]naphthalene-2-carboxamide (CAS 6535-46-2) is a chemical compound with the molecular formula C24H16Cl3N3O2 and a molecular weight of 484.8 g/mol. IUPAC name: 3-hydroxy-N-(2-methylphenyl)-4-[(2,4,5-trichlorophenyl)diazenyl]naphthalene-2-carboxamide. InChIKey: JQNJCQYNSLCFAC-UHFFFAOYSA-N.
| Molecular formula | C24H16Cl3N3O2 |
|---|---|
| Molecular weight | 484.8 g/mol |
| IUPAC name | 3-hydroxy-N-(2-methylphenyl)-4-[(2,4,5-trichlorophenyl)diazenyl]naphthalene-2-carboxamide |
| InChIKey | JQNJCQYNSLCFAC-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C(=C2O)N=NC4=CC(=C(C=C4Cl)Cl)Cl |
Computed by PubChem (NCBI)