CAS 65355-32-0 appears in our catalog under these names: trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic Acid, (Trans,Trans)–4–Propyl–(1,1–Bicyclohexyl)–4–Carboxylic Acid, trans-4-(trans-4-Propylcyclohexyl)cyclohexanecarboxylic acid, 97%, 97%, trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid, 97%, trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 100g, 25g, 5g, 15g.
4-(4-propylcyclohexyl)cyclohexane-1-carboxylic acid (CAS 65355-32-0) is a chemical compound with the molecular formula C16H28O2 and a molecular weight of 252.39 g/mol. IUPAC name: 4-(4-propylcyclohexyl)cyclohexane-1-carboxylic acid. InChIKey: JXPGQFKJNKWDKP-UHFFFAOYSA-N.
| Molecular formula | C16H28O2 |
|---|---|
| Molecular weight | 252.39 g/mol |
| IUPAC name | 4-(4-propylcyclohexyl)cyclohexane-1-carboxylic acid |
| InChIKey | JXPGQFKJNKWDKP-UHFFFAOYSA-N |
| SMILES | CCCC1CCC(CC1)C2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)