CAS 653600-61-4 appears in our catalog under these names: UDP–GalNAz disodium, UDP-GalNAz disodium 98%, Uridine 5'-diphospho-N-acetylazidogalactosamine disodium salt, 95%, 95%, UDP-GalNAz (disodium), 99.89%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 250mg, 10 mg, 5 mg.
CAS 653600-61-4 identifies a chemical compound with the molecular formula C17H26N6Na2O17P2 and a molecular weight of 694.3 g/mol. InChIKey: VIYDEDYDPZOIEF-SGNQCPJASA-N.
| Molecular formula | C17H26N6Na2O17P2 |
|---|---|
| Molecular weight | 694.3 g/mol |
| InChIKey | VIYDEDYDPZOIEF-SGNQCPJASA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O[C@@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)NC(=O)CN=[N+]=[N-])O)O.[Na].[Na] |
Computed by PubChem (NCBI)