Products 65388-03-6
CAS 65388-03-6 is the registry number for alpha-Isowighteone. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-9-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one (CAS 65388-03-6) is a chemical compound with the molecular formula C20H18O5 and a molecular weight of 338.4 g/mol. IUPAC name: 5-hydroxy-9-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one. InChIKey: DXGNQQLBHOTANA-UHFFFAOYSA-N.
| Molecular formula | C20H18O5 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 5-hydroxy-9-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one |
| InChIKey | DXGNQQLBHOTANA-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C3=C(C=C2O)OC=C(C3=O)C4=CC=C(C=C4)O)C |
Computed by PubChem (NCBI)