CAS 654-62-6 appears in our catalog under these names: 4-Amino-6-(trifluoromethyl)benzene-1,3-disulphonamide, 4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide, 2,4-Disulfamyl-5-trifluoromethylaniline, >95% (HPLC), 4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide/ 99.34% (existing batch purity), NSC 44625. Offered by: Mikromol, Biosynth, TRC, TargetMol, GLPBio. Available pack sizes: 4x25mg, 25mg, 2g, 1g, 5g, 10g, 5mg, 10mg.
4-amino-6-(trifluoromethyl)benzene-1,3-disulfonamide (CAS 654-62-6) is a chemical compound with the molecular formula C7H8F3N3O4S2 and a molecular weight of 319.3 g/mol. IUPAC name: 4-amino-6-(trifluoromethyl)benzene-1,3-disulfonamide. InChIKey: KRVABEGPNKGLOT-UHFFFAOYSA-N.
| Molecular formula | C7H8F3N3O4S2 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 4-amino-6-(trifluoromethyl)benzene-1,3-disulfonamide |
| InChIKey | KRVABEGPNKGLOT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)S(=O)(=O)N)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)