CAS 6540-66-5 is the registry number for 6′-Methyl paeonol. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-hydroxy-4-methoxy-6-methylphenyl)ethanone (CAS 6540-66-5) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 1-(2-hydroxy-4-methoxy-6-methylphenyl)ethanone. InChIKey: WJBBJTQRZGMBEM-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-(2-hydroxy-4-methoxy-6-methylphenyl)ethanone |
| InChIKey | WJBBJTQRZGMBEM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)C)O)OC |
Computed by PubChem (NCBI)