CAS 65402-55-3 appears in our catalog under these names: 1,2,3-Propanetrioltris(1,1,1-13C3), 98% 98%atom%13C, 1,2,3-Trioctanoyl-rac-glycerol-13C3, 1,2,3–Trioctanoyl–rac–glycerol–13C3, Tricaprilin-13C3 98% 98%atom%13C, 1,2,3-Trioctanoyl Glycerol-13C3, 98% 98%atom%13C, 98% 98%atom%13C. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 25g, 10mg, 50mg, 100mg, 25mg, 10 mg.
2,3-di((113C)octanoyloxy)propyl (113C)octanoate (CAS 65402-55-3) is a chemical compound with the molecular formula C27H50O6 and a molecular weight of 473.7 g/mol. IUPAC name: 2,3-di((113C)octanoyloxy)propyl (113C)octanoate. InChIKey: VLPFTAMPNXLGLX-UTXJEHKQSA-N.
| Molecular formula | C27H50O6 |
|---|---|
| Molecular weight | 473.7 g/mol |
| IUPAC name | 2,3-di((113C)octanoyloxy)propyl (113C)octanoate |
| InChIKey | VLPFTAMPNXLGLX-UTXJEHKQSA-N |
| SMILES | CCCCCCC[13C](=O)OCC(CO[13C](=O)CCCCCCC)O[13C](=O)CCCCCCC |
Computed by PubChem (NCBI)