CAS 654064-84-3 is the registry number for 3-(3-Aminopropyl)-4-(benzo(d)thiazol-2-yl)-1H-pyrazol-5-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine (CAS 654064-84-3) is a chemical compound with the molecular formula C13H15N5S and a molecular weight of 273.36 g/mol. IUPAC name: 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine. InChIKey: YHCLQAVKRVLZRL-UHFFFAOYSA-N.
| Molecular formula | C13H15N5S |
|---|---|
| Molecular weight | 273.36 g/mol |
| IUPAC name | 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine |
| InChIKey | YHCLQAVKRVLZRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=C(NN=C3N)CCCN |
Computed by PubChem (NCBI)