Products 65410-81-3
CAS 65410-81-3 is the registry number for 2,4-Dibromo-6-chlorobenzoic acid, ≥97.1%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2,4-dibromo-6-chlorobenzoic acid (CAS 65410-81-3) is a chemical compound with the molecular formula C7H3Br2ClO2 and a molecular weight of 314.36 g/mol. IUPAC name: 2,4-dibromo-6-chlorobenzoic acid. InChIKey: ZLDNWXCKNRGTGP-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2ClO2 |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | 2,4-dibromo-6-chlorobenzoic acid |
| InChIKey | ZLDNWXCKNRGTGP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Br)Br |
Computed by PubChem (NCBI)