CAS 65440-93-9 appears in our catalog under these names: (tridecafluorohexyl)benzene, 95%, (Perfluorohexyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylbenzene (CAS 65440-93-9) is a chemical compound with the molecular formula C12H5F13 and a molecular weight of 396.15 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylbenzene. InChIKey: CDMCLELUDINUDU-UHFFFAOYSA-N.
| Molecular formula | C12H5F13 |
|---|---|
| Molecular weight | 396.15 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylbenzene |
| InChIKey | CDMCLELUDINUDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)