CAS 654676-12-7 appears in our catalog under these names: 2,7-Dibromo-9-hexylcarbazole, 95%, 2,7–Dibromo–9–hexylcarbazole, 2,7-Dibromo-9-hexylcarbazole, >98.0%(GC), 2,7-Dibromo-9-hexyl-9H-carbazole 97%, 2,7-Dibromo-9-hexyl-9H-carbazole, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 100g, 25g, 250mg.
2,7-dibromo-9-hexylcarbazole (CAS 654676-12-7) is a chemical compound with the molecular formula C18H19Br2N and a molecular weight of 409.2 g/mol. IUPAC name: 2,7-dibromo-9-hexylcarbazole. InChIKey: YSUUFISKPJBPOH-UHFFFAOYSA-N.
| Molecular formula | C18H19Br2N |
|---|---|
| Molecular weight | 409.2 g/mol |
| IUPAC name | 2,7-dibromo-9-hexylcarbazole |
| InChIKey | YSUUFISKPJBPOH-UHFFFAOYSA-N |
| SMILES | CCCCCCN1C2=C(C=CC(=C2)Br)C3=C1C=C(C=C3)Br |
Computed by PubChem (NCBI)