Products 654683-81-5
CAS 654683-81-5 is the registry number for 1-(3-Methoxyphenyl)-2,2-dimethylpropan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-methoxyphenyl)-2,2-dimethylpropan-1-amine (CAS 654683-81-5) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: 1-(3-methoxyphenyl)-2,2-dimethylpropan-1-amine. InChIKey: HXAMELDWELSLFF-UHFFFAOYSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | HXAMELDWELSLFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC(=CC=C1)OC)N |
Computed by PubChem (NCBI)