Products 65491-21-6
CAS 65491-21-6 appears in our catalog under these names: Methyl acetylacetate–d3, Methyl acetylacetate-d3, 95.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10 mg, 1 mg.
Methyl 4,4,4-trideuterio-3-oxobutanoate (CAS 65491-21-6) is a chemical compound with the molecular formula C5H8O3 and a molecular weight of 119.13 g/mol. IUPAC name: methyl 4,4,4-trideuterio-3-oxobutanoate. InChIKey: WRQNANDWMGAFTP-FIBGUPNXSA-N.
| Molecular formula | C5H8O3 |
|---|---|
| Molecular weight | 119.13 g/mol |
| IUPAC name | methyl 4,4,4-trideuterio-3-oxobutanoate |
| InChIKey | WRQNANDWMGAFTP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)CC(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl acetylacetate-d3