CAS 655-07-2 appears in our catalog under these names: 2,4–Dinitro–1–(trifluoromethoxy)benzene, 2,4-Dinitro(trifluoromethoxy)benzene, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 10g, 1g, 25g, 100g.
2,4-dinitro-1-(trifluoromethoxy)benzene (CAS 655-07-2) is a chemical compound with the molecular formula C7H3F3N2O5 and a molecular weight of 252.10 g/mol. IUPAC name: 2,4-dinitro-1-(trifluoromethoxy)benzene. InChIKey: KYUUZCUXYXNPFO-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2O5 |
|---|---|
| Molecular weight | 252.10 g/mol |
| IUPAC name | 2,4-dinitro-1-(trifluoromethoxy)benzene |
| InChIKey | KYUUZCUXYXNPFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])OC(F)(F)F |
Computed by PubChem (NCBI)