CAS 65527-61-9 appears in our catalog under these names: N-Allylnorlysergic Acid N,N-Diethylamide, >95% (HPLC), AL–LAD (solution), AL-LAD. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1mg, 100μg, 1ML, 1 mg.
(6aR,9R)-N,N-diethyl-7-prop-2-enyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 65527-61-9) is a chemical compound with the molecular formula C22H27N3O and a molecular weight of 349.5 g/mol. IUPAC name: (6aR,9R)-N,N-diethyl-7-prop-2-enyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: JCQLEPDZFXGHHQ-OXQOHEQNSA-N.
| Molecular formula | C22H27N3O |
|---|---|
| Molecular weight | 349.5 g/mol |
| IUPAC name | (6aR,9R)-N,N-diethyl-7-prop-2-enyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | JCQLEPDZFXGHHQ-OXQOHEQNSA-N |
| SMILES | CCN(CC)C(=O)[C@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)CC=C |
Computed by PubChem (NCBI)