CAS 65527-63-1 is the registry number for PRO-LAD, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
(6aR,9R)-N,N-diethyl-7-propyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 65527-63-1) is a chemical compound with the molecular formula C22H29N3O and a molecular weight of 351.5 g/mol. IUPAC name: (6aR,9R)-N,N-diethyl-7-propyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: HZKYLVLOBYNKKM-OXQOHEQNSA-N.
| Molecular formula | C22H29N3O |
|---|---|
| Molecular weight | 351.5 g/mol |
| IUPAC name | (6aR,9R)-N,N-diethyl-7-propyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | HZKYLVLOBYNKKM-OXQOHEQNSA-N |
| SMILES | CCCN1C[C@@H](C=C2[C@H]1CC3=CNC4=CC=CC2=C34)C(=O)N(CC)CC |
Computed by PubChem (NCBI)