CAS 6553-96-4 appears in our catalog under these names: 2,4,6-Triisopropylbenzenesulfonyl Chloride, 2,4,6–Triisopropylbenzenesulfonyl chloride, 2,4,6-Triisopropylbenzenesulfonyl chloride, 98% , 2,4,6-Triisopropylbenzenesulfonyl Chloride, >97.0%(T), 2,4,6-Triisopropylbenzenesulfonyl chloride, 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 10g, 25g, 500g, 0,05kg, 0,025kg, 5g, 1kg.
2,4,6-tri(propan-2-yl)benzenesulfonyl chloride (CAS 6553-96-4) is a chemical compound with the molecular formula C15H23ClO2S and a molecular weight of 302.9 g/mol. IUPAC name: 2,4,6-tri(propan-2-yl)benzenesulfonyl chloride. InChIKey: JAPYIBBSTJFDAK-UHFFFAOYSA-N.
| Molecular formula | C15H23ClO2S |
|---|---|
| Molecular weight | 302.9 g/mol |
| IUPAC name | 2,4,6-tri(propan-2-yl)benzenesulfonyl chloride |
| InChIKey | JAPYIBBSTJFDAK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)S(=O)(=O)Cl)C(C)C |
Computed by PubChem (NCBI)