Products 65538-26-3
CAS 65538-26-3 is the registry number for 2,2-Dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)acetonitrile. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
2,2-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)acetonitrile (CAS 65538-26-3) is a chemical compound with the molecular formula C8H7N and a molecular weight of 124.19 g/mol. IUPAC name: 2,2-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)acetonitrile. InChIKey: SUSQOBVLVYHIEX-XZJKGWKKSA-N.
| Molecular formula | C8H7N |
|---|---|
| Molecular weight | 124.19 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)acetonitrile |
| InChIKey | SUSQOBVLVYHIEX-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C#N)[2H])[2H] |
Computed by PubChem (NCBI)