CAS 65538-30-9 is the registry number for N-Hydroxyamphetamine-d5. Offered by: TRC. Available pack sizes: 10mg.
N-[1-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]hydroxylamine (CAS 65538-30-9) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 156.24 g/mol. IUPAC name: N-[1-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]hydroxylamine. InChIKey: LPZRPPBVFGJUOJ-VIQYUKPQSA-N.
| Molecular formula | C9H13NO |
|---|---|
| Molecular weight | 156.24 g/mol |
| IUPAC name | N-[1-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]hydroxylamine |
| InChIKey | LPZRPPBVFGJUOJ-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC(C)NO)[2H])[2H] |
Computed by PubChem (NCBI)