CAS 65543-72-8 is the registry number for 3,3'-Oxybis(isobenzofuran-1(3H)-one), 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(3-oxo-1H-2-benzofuran-1-yl)oxy]-3H-2-benzofuran-1-one (CAS 65543-72-8) is a chemical compound with the molecular formula C16H10O5 and a molecular weight of 282.25 g/mol. IUPAC name: 3-[(3-oxo-1H-2-benzofuran-1-yl)oxy]-3H-2-benzofuran-1-one. InChIKey: LTOWYDKNFDNQTL-UHFFFAOYSA-N.
| Molecular formula | C16H10O5 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 3-[(3-oxo-1H-2-benzofuran-1-yl)oxy]-3H-2-benzofuran-1-one |
| InChIKey | LTOWYDKNFDNQTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(OC2=O)OC3C4=CC=CC=C4C(=O)O3 |
Computed by PubChem (NCBI)