CAS 65578-62-3 is the registry number for Perfluorotetrahydro-2-furancarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2,3,3,4,4,5,5-heptafluorooxolane-2-carboxylic acid (CAS 65578-62-3) is a chemical compound with the molecular formula C5HF7O3 and a molecular weight of 242.05 g/mol. IUPAC name: 2,3,3,4,4,5,5-heptafluorooxolane-2-carboxylic acid. InChIKey: IJSPOBHLFLGFMQ-UHFFFAOYSA-N.
| Molecular formula | C5HF7O3 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 2,3,3,4,4,5,5-heptafluorooxolane-2-carboxylic acid |
| InChIKey | IJSPOBHLFLGFMQ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1(C(C(C(O1)(F)F)(F)F)(F)F)F)O |
Computed by PubChem (NCBI)