Products 65578-62-3

CAS 65578-62-3 is the registry number for Perfluorotetrahydro-2-furancarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,3,3,4,4,5,5-heptafluorooxolane-2-carboxylic acid (CAS 65578-62-3) is a chemical compound with the molecular formula C5HF7O3 and a molecular weight of 242.05 g/mol. IUPAC name: 2,3,3,4,4,5,5-heptafluorooxolane-2-carboxylic acid. InChIKey: IJSPOBHLFLGFMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5HF7O3
Molecular weight242.05 g/mol
IUPAC name2,3,3,4,4,5,5-heptafluorooxolane-2-carboxylic acid
InChIKeyIJSPOBHLFLGFMQ-UHFFFAOYSA-N
SMILESC(=O)(C1(C(C(C(O1)(F)F)(F)F)(F)F)F)O

Computed by PubChem (NCBI)