CAS 65604-75-3 appears in our catalog under these names: 4-tert-Butylbenzenesulfonohydrazide, 95%, 4-(1,1-Dimethylethyl)benzenesulfonic acid hydrazide, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
4-tert-butylbenzenesulfonohydrazide (CAS 65604-75-3) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 4-tert-butylbenzenesulfonohydrazide. InChIKey: VFQNBUDJNQNYIB-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 4-tert-butylbenzenesulfonohydrazide |
| InChIKey | VFQNBUDJNQNYIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NN |
Computed by PubChem (NCBI)