Products 65619-52-5
CAS 65619-52-5 is the registry number for 4-(4-Bromophenyl)-4-dimethylaminocyclohexanone. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 100mg, 50mg.
4-(4-bromophenyl)-4-(dimethylamino)cyclohexan-1-one (CAS 65619-52-5) is a chemical compound with the molecular formula C14H18BrNO and a molecular weight of 296.20 g/mol. IUPAC name: 4-(4-bromophenyl)-4-(dimethylamino)cyclohexan-1-one. InChIKey: FUNZUWAJMVRIRL-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO |
|---|---|
| Molecular weight | 296.20 g/mol |
| IUPAC name | 4-(4-bromophenyl)-4-(dimethylamino)cyclohexan-1-one |
| InChIKey | FUNZUWAJMVRIRL-UHFFFAOYSA-N |
| SMILES | CN(C)C1(CCC(=O)CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)