Products 656238-35-6
CAS 656238-35-6 is the registry number for 2-Bromo-7-nitro-9,9-dipropyl-9H-fluorene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g.
2-bromo-7-nitro-9,9-dipropylfluorene (CAS 656238-35-6) is a chemical compound with the molecular formula C19H20BrNO2 and a molecular weight of 374.3 g/mol. IUPAC name: 2-bromo-7-nitro-9,9-dipropylfluorene. InChIKey: PXIUUSVBZMAVPX-UHFFFAOYSA-N.
| Molecular formula | C19H20BrNO2 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2-bromo-7-nitro-9,9-dipropylfluorene |
| InChIKey | PXIUUSVBZMAVPX-UHFFFAOYSA-N |
| SMILES | CCCC1(C2=C(C=CC(=C2)[N+](=O)[O-])C3=C1C=C(C=C3)Br)CCC |
Computed by PubChem (NCBI)