CAS 656257-45-3 appears in our catalog under these names: 4–(4–Ethylpiperazin–1–yl)phenylboronic acid pinacol ester, 4-(4-Ethylpiperazin-1-yl)phenylboronic acid pinacol ester, 95%, 95%, 4-(4-Ethylpiperazin-1-yl)phenylboronic acid pinacol ester, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (CAS 656257-45-3) is a chemical compound with the molecular formula C18H29BN2O2 and a molecular weight of 316.2 g/mol. IUPAC name: 1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine. InChIKey: OSJYTVPEVGWXNG-UHFFFAOYSA-N.
| Molecular formula | C18H29BN2O2 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | 1-ethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| InChIKey | OSJYTVPEVGWXNG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCN(CC3)CC |
Computed by PubChem (NCBI)