Products 65655-78-9

CAS 65655-78-9 is the registry number for Ethyl 2,2-dibromo-1-phenylcyclopropane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2,2-dibromo-1-phenylcyclopropane-1-carboxylate (CAS 65655-78-9) is a chemical compound with the molecular formula C12H12Br2O2 and a molecular weight of 348.03 g/mol. IUPAC name: ethyl 2,2-dibromo-1-phenylcyclopropane-1-carboxylate. InChIKey: UPOSJIJWWURTSK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12Br2O2
Molecular weight348.03 g/mol
IUPAC nameethyl 2,2-dibromo-1-phenylcyclopropane-1-carboxylate
InChIKeyUPOSJIJWWURTSK-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC1(Br)Br)C2=CC=CC=C2

Computed by PubChem (NCBI)