CAS 65655-78-9 is the registry number for Ethyl 2,2-dibromo-1-phenylcyclopropane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 2,2-dibromo-1-phenylcyclopropane-1-carboxylate (CAS 65655-78-9) is a chemical compound with the molecular formula C12H12Br2O2 and a molecular weight of 348.03 g/mol. IUPAC name: ethyl 2,2-dibromo-1-phenylcyclopropane-1-carboxylate. InChIKey: UPOSJIJWWURTSK-UHFFFAOYSA-N.
| Molecular formula | C12H12Br2O2 |
|---|---|
| Molecular weight | 348.03 g/mol |
| IUPAC name | ethyl 2,2-dibromo-1-phenylcyclopropane-1-carboxylate |
| InChIKey | UPOSJIJWWURTSK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1(Br)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)