Products 656814-69-6

CAS 656814-69-6 is the registry number for 11-Oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxylic acid 5,5-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid (CAS 656814-69-6) is a chemical compound with the molecular formula C14H9NO5S and a molecular weight of 303.29 g/mol. IUPAC name: 6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid. InChIKey: UEKIEJNYSPXCAW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9NO5S
Molecular weight303.29 g/mol
IUPAC name6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid
InChIKeyUEKIEJNYSPXCAW-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)NC3=C(S2(=O)=O)C=CC(=C3)C(=O)O

Computed by PubChem (NCBI)