CAS 656814-69-6 is the registry number for 11-Oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxylic acid 5,5-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid (CAS 656814-69-6) is a chemical compound with the molecular formula C14H9NO5S and a molecular weight of 303.29 g/mol. IUPAC name: 6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid. InChIKey: UEKIEJNYSPXCAW-UHFFFAOYSA-N.
| Molecular formula | C14H9NO5S |
|---|---|
| Molecular weight | 303.29 g/mol |
| IUPAC name | 6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid |
| InChIKey | UEKIEJNYSPXCAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(S2(=O)=O)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)