Products 65698-22-8
CAS 65698-22-8 appears in our catalog under these names: 1H-Inden-1-one, 2,3-dihydro-4,7-dihydroxy-, 98%, 98%, 4,7-Dihydroxy-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4,7-dihydroxy-2,3-dihydroinden-1-one (CAS 65698-22-8) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4,7-dihydroxy-2,3-dihydroinden-1-one. InChIKey: SKUUVEGAYQHCQE-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4,7-dihydroxy-2,3-dihydroinden-1-one |
| InChIKey | SKUUVEGAYQHCQE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)O)O |
Computed by PubChem (NCBI)