CAS 65718-26-5 appears in our catalog under these names: Ascorbic Acid Impurity 19, L-Ascorbic Acid 2-(Dihydrogen phosphate) N,N-Dicyclohexylcyclohexanamine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N,N-dicyclohexylcyclohexanamine;[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate (CAS 65718-26-5) is a chemical compound with the molecular formula C24H42NO9P and a molecular weight of 519.6 g/mol. IUPAC name: N,N-dicyclohexylcyclohexanamine;[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate. InChIKey: ZQYGMZCRFGEXCT-SXVVAMDVSA-N.
| Molecular formula | C24H42NO9P |
|---|---|
| Molecular weight | 519.6 g/mol |
| IUPAC name | N,N-dicyclohexylcyclohexanamine;[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
| InChIKey | ZQYGMZCRFGEXCT-SXVVAMDVSA-N |
| SMILES | C1CCC(CC1)N(C2CCCCC2)C3CCCCC3.C([C@@H]([C@@H]1C(=C(C(=O)O1)OP(=O)(O)O)O)O)O |
Computed by PubChem (NCBI)