CAS 65750-02-9 appears in our catalog under these names: 6-Nitro-2H-indazole 95%, 6-Nitro-2H-indazole, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 25g, 100g, 500g.
6-nitro-1H-indazole (CAS 65750-02-9) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 6-nitro-1H-indazole. InChIKey: ORZRMRUXSPNQQL-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 6-nitro-1H-indazole |
| InChIKey | ORZRMRUXSPNQQL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NN=C2 |
Computed by PubChem (NCBI)