CAS 658-46-8 is the registry number for 4-(1,1,2,2,2-Pentafluoroethoxy)phenol 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-(1,1,2,2,2-pentafluoroethoxy)phenol (CAS 658-46-8) is a chemical compound with the molecular formula C8H5F5O2 and a molecular weight of 228.12 g/mol. IUPAC name: 4-(1,1,2,2,2-pentafluoroethoxy)phenol. InChIKey: SSIHBJIMARRDHZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F5O2 |
|---|---|
| Molecular weight | 228.12 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentafluoroethoxy)phenol |
| InChIKey | SSIHBJIMARRDHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)