CAS 658043-41-5 is the registry number for 3,4-Dichloro-5-(p-tolyl)furan-2(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-2-(4-methylphenyl)-2H-furan-5-one (CAS 658043-41-5) is a chemical compound with the molecular formula C11H8Cl2O2 and a molecular weight of 243.08 g/mol. IUPAC name: 3,4-dichloro-2-(4-methylphenyl)-2H-furan-5-one. InChIKey: FNVICNXKYOABMK-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2O2 |
|---|---|
| Molecular weight | 243.08 g/mol |
| IUPAC name | 3,4-dichloro-2-(4-methylphenyl)-2H-furan-5-one |
| InChIKey | FNVICNXKYOABMK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C(=C(C(=O)O2)Cl)Cl |
Computed by PubChem (NCBI)