CAS 65826-97-3 appears in our catalog under these names: 5-(tert-Butyl)indoline, 95%, 5-tert-Butyl-2,3-dihydro-1H-indole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-tert-butyl-2,3-dihydro-1H-indole (CAS 65826-97-3) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: 5-tert-butyl-2,3-dihydro-1H-indole. InChIKey: DCWWFXGCBMZVFC-UHFFFAOYSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | 5-tert-butyl-2,3-dihydro-1H-indole |
| InChIKey | DCWWFXGCBMZVFC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NCC2 |
Computed by PubChem (NCBI)