Products 6586-37-4
CAS 6586-37-4 is the registry number for K027. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-carboxamide dibromide (CAS 6586-37-4) is a chemical compound with the molecular formula C15H18Br2N4O2 and a molecular weight of 446.14 g/mol. IUPAC name: 1-[3-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-carboxamide dibromide. InChIKey: GUKLPXXRDXZMIV-UHFFFAOYSA-N.
| Molecular formula | C15H18Br2N4O2 |
|---|---|
| Molecular weight | 446.14 g/mol |
| IUPAC name | 1-[3-[4-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-carboxamide dibromide |
| InChIKey | GUKLPXXRDXZMIV-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1/C=N/O)CCC[N+]2=CC=C(C=C2)C(=O)N.[Br-].[Br-] |
Computed by PubChem (NCBI)
Synonyms:
K-27 cpd