CAS 658683-16-0 appears in our catalog under these names: 4-chloro-2,3-dihydroisoindol-1-one, 97%, 7-Chloroisoindolin-1-one 96%, 4-chloro-2,3-dihydroisoindol-1-one, 96%, 96%, 7-Chloroisoindolin-1-one, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 500mg, 50mg, 2.5g.
7-chloro-2,3-dihydroisoindol-1-one (CAS 658683-16-0) is a chemical compound with the molecular formula C8H6ClNO and a molecular weight of 167.59 g/mol. IUPAC name: 7-chloro-2,3-dihydroisoindol-1-one. InChIKey: VINJECBDFXCRNA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO |
|---|---|
| Molecular weight | 167.59 g/mol |
| IUPAC name | 7-chloro-2,3-dihydroisoindol-1-one |
| InChIKey | VINJECBDFXCRNA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)Cl)C(=O)N1 |
Computed by PubChem (NCBI)