CAS 659-18-7 appears in our catalog under these names: Tris(2,2,2-trifluoroethyl) borate, 95%, tris(2,2,2–trifluoroethyl) borate , Tris(2,2,2-trifluoroethyl) borate, Tris(2,2,2-trifluoroethyl) Borate, >95.0%(T), Tris(2,2,2-trifluoroethyl) borate 98%. Offered by: Combi-blocks, GLPBio, TargetMol, TCI, Ambeed. Available pack sizes: 25g, 5g, 100g, 10g, 1g, 10mg, 50mg, 5mg.
Tris(2,2,2-trifluoroethyl) borate (CAS 659-18-7) is a chemical compound with the molecular formula C6H6BF9O3 and a molecular weight of 307.91 g/mol. IUPAC name: tris(2,2,2-trifluoroethyl) borate. InChIKey: DIEXQJFSUBBIRP-UHFFFAOYSA-N.
| Molecular formula | C6H6BF9O3 |
|---|---|
| Molecular weight | 307.91 g/mol |
| IUPAC name | tris(2,2,2-trifluoroethyl) borate |
| InChIKey | DIEXQJFSUBBIRP-UHFFFAOYSA-N |
| SMILES | B(OCC(F)(F)F)(OCC(F)(F)F)OCC(F)(F)F |
Computed by PubChem (NCBI)